C30H39N3O4 — CID 123736073
4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol (PubChem CID 123736073) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol.
| Compound Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
|---|---|
| PubChem CID | 123736073 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
| SMILES | CC1C2CC(c3c2c(O)n(C[C@H]2CCCC[C@@H]2CN2CCC(c4noc5ccccc45)CC2)c3O)C1O |
| InChI | InChI=1S/C30H39N3O4/c1-17-22-14-23(28(17)34)26-25(22)29(35)33(30(26)36)16-20-7-3-2-6-19(20)15-32-12-10-18(11-13-32)27-21-8-4-5-9-24(21)37-31-27/h4-5,8-9,17-20,22-23,28,34-36H,2-3,6-7,10-16H2,1H3/t17?,19-,20-,22?,23?,28?/m1/s1 |
| InChIKey | LRJCRPDBTAYHGG-UOUCBTNTSA-N |
| XLogP | 5.31 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |