C28H36N4O4 — CID 123622261
4-[[(1S,2S)-2-[[4-(2H-indazol-3-yl)piperidin-1-yl]methyl]cyclopentyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8,9-tetrol (PubChem CID 123622261) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[[4-(2H-indazol-3-yl)piperidin-1-yl]methyl]cyclopentyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8,9-tetrol.
| Compound Name | 4-[[(1S,2S)-2-[[4-(2H-indazol-3-yl)piperidin-1-yl]methyl]cyclopentyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8,9-tetrol |
|---|---|
| PubChem CID | 123622261 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 4-[[(1S,2S)-2-[[4-(2H-indazol-3-yl)piperidin-1-yl]methyl]cyclopentyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8,9-tetrol |
| SMILES | Oc1c2c(c(O)n1C[C@H]1CCC[C@@H]1CN1CCC(c3[nH]nc4ccccc34)CC1)C1CC2C(O)C1O |
| InChI | InChI=1S/C28H36N4O4/c33-25-19-12-20(26(25)34)23-22(19)27(35)32(28(23)36)14-17-5-3-4-16(17)13-31-10-8-15(9-11-31)24-18-6-1-2-7-21(18)29-30-24/h1-2,6-7,15-17,19-20,25-26,33-36H,3-5,8-14H2,(H,29,30)/t16-,17-,19?,20?,25?,26?/m1/s1 |
| InChIKey | YKGBXAXTCXITMH-CFDDICMDSA-N |
| XLogP | 3.38 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |