C12H8N4O2 — CID 135516464
3-(furan-2-yl)-6-pyridin-4-yl-4H-1,2,4-triazin-5-one (PubChem CID 135516464) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-(furan-2-yl)-6-pyridin-4-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(furan-2-yl)-6-pyridin-4-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135516464 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(furan-2-yl)-6-pyridin-4-yl-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(-c2ccco2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C12H8N4O2/c17-12-10(8-3-5-13-6-4-8)15-16-11(14-12)9-2-1-7-18-9/h1-7H,(H,14,16,17) |
| InChIKey | WJQIBGHLTGMDRZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |