About N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide
N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide (PubChem CID 135517979) has the molecular formula C13H12N6O3
and a molecular weight of 300.28 g/mol. Its IUPAC name is N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide |
| PubChem CID | 135517979 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide |
| SMILES | NC(=N[N+](=O)[O-])Nc1ccc(NC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C13H12N6O3/c14-13(18-19(21)22)17-10-6-4-9(5-7-10)16-12(20)11-3-1-2-8-15-11/h1-8H,(H,16,20)(H3,14,17,18) |
| InChIKey | QRUCWKYUVADYMU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide?
The IUPAC name of N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide (CID 135517979) is N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide.
What is the SMILES notation for N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide?
The canonical SMILES for N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide is NC(=N[N+](=O)[O-])Nc1ccc(NC(=O)c2ccccn2)cc1.
What is the InChIKey of N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide?
The InChIKey is QRUCWKYUVADYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6O3/c14-13(18-19(21)22)17-10-6-4-9(5-7-10)16-12(20)11-3-1-2-8-15-11/h1-8H,(H,16,20)(H3,14,17,18).
What are the key properties of N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide?
N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide has a molecular weight of 300.28 g/mol, XLogP of 1.25, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(N'-nitrocarbamimidoyl)amino]phenyl]pyridine-2-carboxamide is sourced from PubChem (CID 135517979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).