C25H27N3O2 — CID 135519574
3-hydroxy-5,5-dimethyl-2-[N-(phenanthridin-6-ylamino)-C-propylcarbonimidoyl]cyclohex-2-en-1-one (PubChem CID 135519574) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[N-(phenanthridin-6-ylamino)-C-propylcarbonimidoyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[N-(phenanthridin-6-ylamino)-C-propylcarbonimidoyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135519574 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[N-(phenanthridin-6-ylamino)-C-propylcarbonimidoyl]cyclohex-2-en-1-one |
| SMILES | CCCC(=NNc1nc2ccccc2c2ccccc12)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C25H27N3O2/c1-4-9-20(23-21(29)14-25(2,3)15-22(23)30)27-28-24-18-12-6-5-10-16(18)17-11-7-8-13-19(17)26-24/h5-8,10-13,29H,4,9,14-15H2,1-3H3,(H,26,28) |
| InChIKey | YFRIGLAXGINPOY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|