C19H17N3O2 — CID 135519892
4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]benzene-1,3-diol (PubChem CID 135519892) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135519892 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C(Cc2ccccn2)=N\Nc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C19H17N3O2/c23-16-9-10-17(19(24)13-16)18(12-15-8-4-5-11-20-15)22-21-14-6-2-1-3-7-14/h1-11,13,21,23-24H,12H2/b22-18- |
| InChIKey | ZXQYRKFTWABQDF-PYCFMQQDSA-N |
| XLogP | 3.55 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|