C21H21N3O2 — CID 135519929
4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]-6-ethylbenzene-1,3-diol (PubChem CID 135519929) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]-6-ethylbenzene-1,3-diol.
| Compound Name | 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]-6-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 135519929 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[(Z)-N-anilino-C-(pyridin-2-ylmethyl)carbonimidoyl]-6-ethylbenzene-1,3-diol |
| SMILES | CCc1cc(/C(Cc2ccccn2)=N\Nc2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C21H21N3O2/c1-2-15-12-18(21(26)14-20(15)25)19(13-17-10-6-7-11-22-17)24-23-16-8-4-3-5-9-16/h3-12,14,23,25-26H,2,13H2,1H3/b24-19- |
| InChIKey | NZNJDADVEFGWPH-CLCOLTQESA-N |
| XLogP | 4.11 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|