C15H15Br2N3OS — CID 135520604
1-[(2S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 135520604) has the molecular formula C15H15Br2N3OS and a molecular weight of 445.18 g/mol. Its IUPAC name is 1-[(2S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(2S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135520604 |
| Molecular Formula | C15H15Br2N3OS |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | 1-[(2S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/NC(=S)N[C@H]1CC2C=CC1C2 |
| InChI | InChI=1S/C15H15Br2N3OS/c16-11-5-10(14(21)12(17)6-11)7-18-20-15(22)19-13-4-8-1-2-9(13)3-8/h1-2,5-9,13,21H,3-4H2,(H2,19,20,22)/b18-7+/t8?,9?,13-/m0/s1 |
| InChIKey | TZDQUZYIATYIIL-HPWKYORPSA-N |
| XLogP | 3.68 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|