C9H9Br2N3OS — CID 135667284
1-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea (PubChem CID 135667284) has the molecular formula C9H9Br2N3OS and a molecular weight of 367.07 g/mol. Its IUPAC name is 1-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 135667284 |
| Molecular Formula | C9H9Br2N3OS |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 1-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H9Br2N3OS/c1-12-9(16)14-13-4-5-2-6(10)3-7(11)8(5)15/h2-4,15H,1H3,(H2,12,14,16)/b13-4- |
| InChIKey | KLONKKLSBDSLRJ-PQMHYQBVSA-N |
| XLogP | 2.35 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|