C24H24Cl2N3O2S+ — CID 135521050
3-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-hydroxy-N-[(4-methoxyphenyl)methyl]prop-2-enethioamide (PubChem CID 135521050) has the molecular formula C24H24Cl2N3O2S+ and a molecular weight of 489.45 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-hydroxy-N-[(4-methoxyphenyl)methyl]prop-2-enethioamide.
| Compound Name | 3-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-hydroxy-N-[(4-methoxyphenyl)methyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 135521050 |
| Molecular Formula | C24H24Cl2N3O2S+ |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-hydroxy-N-[(4-methoxyphenyl)methyl]prop-2-enethioamide |
| SMILES | COc1ccc(CNC(=S)C(=C(O)c2ccc(Cl)cc2Cl)[n+]2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O2S/c1-28(2)18-10-12-29(13-11-18)22(23(30)20-9-6-17(25)14-21(20)26)24(32)27-15-16-4-7-19(31-3)8-5-16/h4-14H,15H2,1-3H3,(H-,27,30,32)/p+1 |
| InChIKey | MCJAGALXWJOQJG-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 48.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|