C24H23Cl2N3O2S — CID 3372033
1-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[(4-methoxyphenyl)methylamino]-3-sulfanylideneprop-1-en-1-olate (PubChem CID 3372033) has the molecular formula C24H23Cl2N3O2S and a molecular weight of 488.44 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[(4-methoxyphenyl)methylamino]-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[(4-methoxyphenyl)methylamino]-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 3372033 |
| Molecular Formula | C24H23Cl2N3O2S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[(4-methoxyphenyl)methylamino]-3-sulfanylideneprop-1-en-1-olate |
| SMILES | COc1ccc(CNC(=S)C(=C([O-])c2ccc(Cl)cc2Cl)[n+]2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O2S/c1-28(2)18-10-12-29(13-11-18)22(23(30)20-9-6-17(25)14-21(20)26)24(32)27-15-16-4-7-19(31-3)8-5-16/h4-14H,15H2,1-3H3,(H-,27,30,32) |
| InChIKey | MCJAGALXWJOQJG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|