C11H11FN2OS — CID 135523629
5-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135523629) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135523629 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCC1S/C(=N\c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C11H11FN2OS/c1-2-9-10(15)14-11(16-9)13-8-5-3-7(12)4-6-8/h3-6,9H,2H2,1H3,(H,13,14,15) |
| InChIKey | YNCOAHHZTLKACK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|