C24H21N5O2 — CID 135524089
6-[2-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]-4-pyridinyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135524089) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 6-[2-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]-4-pyridinyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-[2-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]-4-pyridinyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135524089 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 6-[2-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]-4-pyridinyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2[nH]c(-c3ccnc(C#Cc4ccc(CN5CCOCC5)cc4)c3)cc12 |
| InChI | InChI=1S/C24H21N5O2/c30-24-21-14-22(28-23(21)26-16-27-24)19-7-8-25-20(13-19)6-5-17-1-3-18(4-2-17)15-29-9-11-31-12-10-29/h1-4,7-8,13-14,16H,9-12,15H2,(H2,26,27,28,30) |
| InChIKey | STTHMURQAVSFPT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|