C17H17NO5 — CID 135524534
methyl 5-[(2,5-dimethoxyphenyl)iminomethyl]-2-hydroxybenzoate (PubChem CID 135524534) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 5-[(2,5-dimethoxyphenyl)iminomethyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[(2,5-dimethoxyphenyl)iminomethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 135524534 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 5-[(2,5-dimethoxyphenyl)iminomethyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(/C=N/c2cc(OC)ccc2OC)ccc1O |
| InChI | InChI=1S/C17H17NO5/c1-21-12-5-7-16(22-2)14(9-12)18-10-11-4-6-15(19)13(8-11)17(20)23-3/h4-10,19H,1-3H3/b18-10+ |
| InChIKey | ONWIQZBAPLINCI-VCHYOVAHSA-N |
| XLogP | 2.95 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|