C17H11N4O2- — CID 135526748
[2-(1H-benzimidazol-2-yl)-3-(3-carboxyphenyl)iminoprop-1-enylidene]azanide (PubChem CID 135526748) has the molecular formula C17H11N4O2- and a molecular weight of 303.30 g/mol. Its IUPAC name is [2-(1H-benzimidazol-2-yl)-3-(3-carboxyphenyl)iminoprop-1-enylidene]azanide.
| Compound Name | [2-(1H-benzimidazol-2-yl)-3-(3-carboxyphenyl)iminoprop-1-enylidene]azanide |
|---|---|
| PubChem CID | 135526748 |
| Molecular Formula | C17H11N4O2- |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [2-(1H-benzimidazol-2-yl)-3-(3-carboxyphenyl)iminoprop-1-enylidene]azanide |
| SMILES | [N-]=C=C(/C=N/c1cccc(C(=O)O)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H11N4O2/c18-9-12(16-20-14-6-1-2-7-15(14)21-16)10-19-13-5-3-4-11(8-13)17(22)23/h1-8,10H,(H,20,21)(H,22,23)/q-1/b19-10+ |
| InChIKey | CFSRBHCMIOPGRD-VXLYETTFSA-N |
| XLogP | 3.29 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|