C19H14N2O5 — CID 135526879
3-hydroxy-2-[[6-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]iminomethyl]inden-1-one (PubChem CID 135526879) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 3-hydroxy-2-[[6-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]iminomethyl]inden-1-one.
| Compound Name | 3-hydroxy-2-[[6-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]iminomethyl]inden-1-one |
|---|---|
| PubChem CID | 135526879 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-hydroxy-2-[[6-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]iminomethyl]inden-1-one |
| SMILES | C/C(=N\O)c1cc2c(cc1/N=C/C1=C(O)c3ccccc3C1=O)OCO2 |
| InChI | InChI=1S/C19H14N2O5/c1-10(21-24)13-6-16-17(26-9-25-16)7-15(13)20-8-14-18(22)11-4-2-3-5-12(11)19(14)23/h2-8,22,24H,9H2,1H3/b20-8+,21-10+ |
| InChIKey | BYLMAYWXJKKTEX-GTGODNQPSA-N |
| XLogP | 3.48 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|