C17H11NO5 — CID 168519754
2-(6-acetyl-1,3-benzodioxol-5-yl)isoindole-1,3-dione (PubChem CID 168519754) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-(6-acetyl-1,3-benzodioxol-5-yl)isoindole-1,3-dione.
| Compound Name | 2-(6-acetyl-1,3-benzodioxol-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519754 |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(6-acetyl-1,3-benzodioxol-5-yl)isoindole-1,3-dione |
| SMILES | CC(=O)c1cc2c(cc1N1C(=O)c3ccccc3C1=O)OCO2 |
| InChI | InChI=1S/C17H11NO5/c1-9(19)12-6-14-15(23-8-22-14)7-13(12)18-16(20)10-4-2-3-5-11(10)17(18)21/h2-7H,8H2,1H3 |
| InChIKey | GOCYNMXNRYBBLO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|