C14H13F3N4O2S — CID 135530402
(3-methoxyphenyl)methyl N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidothioate (PubChem CID 135530402) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidothioate.
| Compound Name | (3-methoxyphenyl)methyl N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 135530402 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (3-methoxyphenyl)methyl N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidothioate |
| SMILES | COc1cccc(CSC(N)=Nc2nc(C(F)(F)F)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H13F3N4O2S/c1-23-9-4-2-3-8(5-9)7-24-12(18)21-13-19-10(14(15,16)17)6-11(22)20-13/h2-6H,7H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | RRFUSMZUFCNVCA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|