C17H20N10O11P2 — CID 135531352
[(2-amino-4-oxo-3H-pteridin-6-yl)methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 135531352) has the molecular formula C17H20N10O11P2 and a molecular weight of 602.35 g/mol. Its IUPAC name is [(2-amino-4-oxo-3H-pteridin-6-yl)methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2-amino-4-oxo-3H-pteridin-6-yl)methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 135531352 |
| Molecular Formula | C17H20N10O11P2 |
| Molecular Weight | 602.35 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | [(2-amino-4-oxo-3H-pteridin-6-yl)methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2ncc(COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H20N10O11P2/c18-12-8-14(22-4-21-12)27(5-23-8)16-11(29)10(28)7(37-16)3-36-40(33,34)38-39(31,32)35-2-6-1-20-13-9(24-6)15(30)26-17(19)25-13/h1,4-5,7,10-11,16,28-29H,2-3H2,(H,31,32)(H,33,34)(H2,18,21,22)(H3,19,20,25,26,30)/t7-,10-,11-,16-/m1/s1 |
| InChIKey | XBNGLNCHZMEECI-SUGPNEFASA-N |
| XLogP | -1.91 |
| TPSA | 319.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.35 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|