C17H16N10O6 — CID 135567283
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-amino-4-oxo-3H-pteridine-6-carboxylate (PubChem CID 135567283) has the molecular formula C17H16N10O6 and a molecular weight of 456.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-amino-4-oxo-3H-pteridine-6-carboxylate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-amino-4-oxo-3H-pteridine-6-carboxylate |
|---|---|
| PubChem CID | 135567283 |
| Molecular Formula | C17H16N10O6 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-amino-4-oxo-3H-pteridine-6-carboxylate |
| SMILES | Nc1nc2ncc(C(=O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H16N10O6/c18-11-7-13(22-3-21-11)27(4-23-7)15-10(29)9(28)6(33-15)2-32-16(31)5-1-20-12-8(24-5)14(30)26-17(19)25-12/h1,3-4,6,9-10,15,28-29H,2H2,(H2,18,21,22)(H3,19,20,25,26,30)/t6-,9-,10-,15-/m1/s1 |
| InChIKey | INIBCQZJBGQGDM-NCEGKOTBSA-N |
| XLogP | -2.51 |
| TPSA | 243.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |