C24H30N12O5S — CID 162647050
2-amino-N-[2-[4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]piperidin-1-yl]ethyl]-4-oxo-3H-pteridine-6-carboxamide (PubChem CID 162647050) has the molecular formula C24H30N12O5S and a molecular weight of 598.65 g/mol. Its IUPAC name is 2-amino-N-[2-[4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]piperidin-1-yl]ethyl]-4-oxo-3H-pteridine-6-carboxamide.
| Compound Name | 2-amino-N-[2-[4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]piperidin-1-yl]ethyl]-4-oxo-3H-pteridine-6-carboxamide |
|---|---|
| PubChem CID | 162647050 |
| Molecular Formula | C24H30N12O5S |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 2-amino-N-[2-[4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]piperidin-1-yl]ethyl]-4-oxo-3H-pteridine-6-carboxamide |
| SMILES | Nc1nc2ncc(C(=O)NCCN3CCC(SC[C@H]4O[C@@H](n5cnc6c(N)ncnc65)[C@H](O)[C@@H]4O)CC3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H30N12O5S/c25-18-14-20(30-9-29-18)36(10-31-14)23-17(38)16(37)13(41-23)8-42-11-1-4-35(5-2-11)6-3-27-21(39)12-7-28-19-15(32-12)22(40)34-24(26)33-19/h7,9-11,13,16-17,23,37-38H,1-6,8H2,(H,27,39)(H2,25,29,30)(H3,26,28,33,34,40)/t13-,16-,17-,23-/m1/s1 |
| InChIKey | YFZADTZZJWYJFL-OFWYVSERSA-N |
| XLogP | -1.74 |
| TPSA | 249.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |