C19H15Cl3F3N5O3 — CID 135533991
5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(2,4-dichlorophenyl)methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 135533991) has the molecular formula C19H15Cl3F3N5O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(2,4-dichlorophenyl)methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(2,4-dichlorophenyl)methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135533991 |
| Molecular Formula | C19H15Cl3F3N5O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | 5-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-N-[(2,4-dichlorophenyl)methoxyiminomethyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC=NOCc1ccc(Cl)cc1Cl)C1=NOC(CNc2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C19H15Cl3F3N5O3/c20-12-2-1-10(14(21)4-12)8-32-29-9-28-18(31)16-5-13(33-30-16)7-27-17-15(22)3-11(6-26-17)19(23,24)25/h1-4,6,9,13H,5,7-8H2,(H,26,27)(H,28,29,31) |
| InChIKey | ZQLMWOJUILKAGL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|