C18H12Cl3F3N4O2S — CID 20850402
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-[3-[(2,4-dichlorophenyl)methoxy]thiophen-2-yl]urea (PubChem CID 20850402) has the molecular formula C18H12Cl3F3N4O2S and a molecular weight of 511.74 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-[3-[(2,4-dichlorophenyl)methoxy]thiophen-2-yl]urea.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-[3-[(2,4-dichlorophenyl)methoxy]thiophen-2-yl]urea |
|---|---|
| PubChem CID | 20850402 |
| Molecular Formula | C18H12Cl3F3N4O2S |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-[3-[(2,4-dichlorophenyl)methoxy]thiophen-2-yl]urea |
| SMILES | NC(=O)N(Nc1ncc(C(F)(F)F)cc1Cl)c1sccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl3F3N4O2S/c19-11-2-1-9(12(20)6-11)8-30-14-3-4-31-16(14)28(17(25)29)27-15-13(21)5-10(7-26-15)18(22,23)24/h1-7H,8H2,(H2,25,29)(H,26,27) |
| InChIKey | YNMFKQJYYVTJSJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|