C16H11ClN6OS — CID 135534243
5-chloro-6-methyl-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one (PubChem CID 135534243) has the molecular formula C16H11ClN6OS and a molecular weight of 370.83 g/mol. Its IUPAC name is 5-chloro-6-methyl-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one.
| Compound Name | 5-chloro-6-methyl-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one |
|---|---|
| PubChem CID | 135534243 |
| Molecular Formula | C16H11ClN6OS |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 5-chloro-6-methyl-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one |
| SMILES | Cc1cc2c(cc1Cl)C(=Nn1c(-c3ccncc3)n[nH]c1=S)C(=O)N2 |
| InChI | InChI=1S/C16H11ClN6OS/c1-8-6-12-10(7-11(8)17)13(15(24)19-12)22-23-14(20-21-16(23)25)9-2-4-18-5-3-9/h2-7H,1H3,(H,21,25)(H,19,22,24) |
| InChIKey | NANFRODQRDDDNW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|