C20H18BrN7O2S — CID 5481130
(3E)-5-bromo-1-(morpholin-4-ylmethyl)-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]indol-2-one (PubChem CID 5481130) has the molecular formula C20H18BrN7O2S and a molecular weight of 500.38 g/mol. Its IUPAC name is (3E)-5-bromo-1-(morpholin-4-ylmethyl)-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]indol-2-one.
| Compound Name | (3E)-5-bromo-1-(morpholin-4-ylmethyl)-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]indol-2-one |
|---|---|
| PubChem CID | 5481130 |
| Molecular Formula | C20H18BrN7O2S |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | (3E)-5-bromo-1-(morpholin-4-ylmethyl)-3-[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]indol-2-one |
| SMILES | O=C1/C(=N/n2c(-c3ccncc3)n[nH]c2=S)c2cc(Br)ccc2N1CN1CCOCC1 |
| InChI | InChI=1S/C20H18BrN7O2S/c21-14-1-2-16-15(11-14)17(19(29)27(16)12-26-7-9-30-10-8-26)25-28-18(23-24-20(28)31)13-3-5-22-6-4-13/h1-6,11H,7-10,12H2,(H,24,31)/b25-17+ |
| InChIKey | JWAMOIUIUFLHAU-KOEQRZSOSA-N |
| XLogP | 2.65 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|