C27H25N3O4S — CID 135535024
methyl 4-[2-[(4-methylphenyl)methylsulfanyl]-4,6-dioxo-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoate (PubChem CID 135535024) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl 4-[2-[(4-methylphenyl)methylsulfanyl]-4,6-dioxo-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoate.
| Compound Name | methyl 4-[2-[(4-methylphenyl)methylsulfanyl]-4,6-dioxo-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoate |
|---|---|
| PubChem CID | 135535024 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | methyl 4-[2-[(4-methylphenyl)methylsulfanyl]-4,6-dioxo-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CCCC3=O)Nc3nc(SCc4ccc(C)cc4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-15-6-8-16(9-7-15)14-35-27-29-24-23(25(32)30-27)21(22-19(28-24)4-3-5-20(22)31)17-10-12-18(13-11-17)26(33)34-2/h6-13,21H,3-5,14H2,1-2H3,(H2,28,29,30,32) |
| InChIKey | FEFLTKGBTROIGM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |