C16H14N4OS — CID 135537826
1-(4-methylphenyl)-3-(4-oxo-3H-quinazolin-6-yl)thiourea (PubChem CID 135537826) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(4-oxo-3H-quinazolin-6-yl)thiourea.
| Compound Name | 1-(4-methylphenyl)-3-(4-oxo-3H-quinazolin-6-yl)thiourea |
|---|---|
| PubChem CID | 135537826 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(4-methylphenyl)-3-(4-oxo-3H-quinazolin-6-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3nc[nH]c(=O)c3c2)cc1 |
| InChI | InChI=1S/C16H14N4OS/c1-10-2-4-11(5-3-10)19-16(22)20-12-6-7-14-13(8-12)15(21)18-9-17-14/h2-9H,1H3,(H,17,18,21)(H2,19,20,22) |
| InChIKey | NFUCKSWQHUQZSB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|