C23H20N2O — CID 135540827
4-(5-ethyl-1,4-diphenylimidazol-2-yl)phenol (PubChem CID 135540827) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(5-ethyl-1,4-diphenylimidazol-2-yl)phenol.
| Compound Name | 4-(5-ethyl-1,4-diphenylimidazol-2-yl)phenol |
|---|---|
| PubChem CID | 135540827 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(5-ethyl-1,4-diphenylimidazol-2-yl)phenol |
| SMILES | CCc1c(-c2ccccc2)nc(-c2ccc(O)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c1-2-21-22(17-9-5-3-6-10-17)24-23(18-13-15-20(26)16-14-18)25(21)19-11-7-4-8-12-19/h3-16,26H,2H2,1H3 |
| InChIKey | LNBMXRZXDFQVDG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |