C20H18N4O2S — CID 135541274
4-methyl-5-(1-phenyltetrazol-5-yl)sulfanyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,6-diol (PubChem CID 135541274) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-methyl-5-(1-phenyltetrazol-5-yl)sulfanyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,6-diol.
| Compound Name | 4-methyl-5-(1-phenyltetrazol-5-yl)sulfanyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,6-diol |
|---|---|
| PubChem CID | 135541274 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-methyl-5-(1-phenyltetrazol-5-yl)sulfanyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,6-diol |
| SMILES | Cc1c(O)c2c(c(O)c1Sc1nnnn1-c1ccccc1)C1C=CC2CC1 |
| InChI | InChI=1S/C20H18N4O2S/c1-11-17(25)15-12-7-9-13(10-8-12)16(15)18(26)19(11)27-20-21-22-23-24(20)14-5-3-2-4-6-14/h2-7,9,12-13,25-26H,8,10H2,1H3 |
| InChIKey | BPFIAARDHLVVAX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|