C21H19N5O2S — CID 135626882
2-(3,5-dimethylanilino)-5-(1-phenyltetrazol-5-yl)sulfanylbenzene-1,4-diol (PubChem CID 135626882) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-5-(1-phenyltetrazol-5-yl)sulfanylbenzene-1,4-diol.
| Compound Name | 2-(3,5-dimethylanilino)-5-(1-phenyltetrazol-5-yl)sulfanylbenzene-1,4-diol |
|---|---|
| PubChem CID | 135626882 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-(3,5-dimethylanilino)-5-(1-phenyltetrazol-5-yl)sulfanylbenzene-1,4-diol |
| SMILES | Cc1cc(C)cc(Nc2cc(O)c(Sc3nnnn3-c3ccccc3)cc2O)c1 |
| InChI | InChI=1S/C21H19N5O2S/c1-13-8-14(2)10-15(9-13)22-17-11-19(28)20(12-18(17)27)29-21-23-24-25-26(21)16-6-4-3-5-7-16/h3-12,22,27-28H,1-2H3 |
| InChIKey | LZSCNSKVSPCHEM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|