C21H19N3O3S — CID 135541993
(E)-3-[4-[(4-benzyl-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 135541993) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is (E)-3-[4-[(4-benzyl-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[(4-benzyl-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 135541993 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (E)-3-[4-[(4-benzyl-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CSc2nc(Cc3ccccc3)cc(=O)[nH]2)cc1)NO |
| InChI | InChI=1S/C21H19N3O3S/c25-19(24-27)11-10-15-6-8-17(9-7-15)14-28-21-22-18(13-20(26)23-21)12-16-4-2-1-3-5-16/h1-11,13,27H,12,14H2,(H,24,25)(H,22,23,26)/b11-10+ |
| InChIKey | OXKATUPKSIUGOH-ZHACJKMWSA-N |
| XLogP | 3.17 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|