C27H24N4O2 — CID 135542792
2-[[methyl-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 135542792) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[[methyl-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[methyl-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135542792 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[[methyl-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | CN(CC(=O)c1c(-c2ccccc2)n(C)c2ccccc12)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C27H24N4O2/c1-30(17-24-28-21-14-8-6-12-19(21)27(33)29-24)16-23(32)25-20-13-7-9-15-22(20)31(2)26(25)18-10-4-3-5-11-18/h3-15H,16-17H2,1-2H3,(H,28,29,33) |
| InChIKey | OURNQYIGSUTBEM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |