C18H17FN4S — CID 135545382
3-[6-(4-fluoropiperidin-4-yl)-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole (PubChem CID 135545382) has the molecular formula C18H17FN4S and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[6-(4-fluoropiperidin-4-yl)-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole.
| Compound Name | 3-[6-(4-fluoropiperidin-4-yl)-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole |
|---|---|
| PubChem CID | 135545382 |
| Molecular Formula | C18H17FN4S |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[6-(4-fluoropiperidin-4-yl)-1H-indol-2-yl]-1H-thieno[3,2-c]pyrazole |
| SMILES | FC1(c2ccc3cc(-c4n[nH]c5ccsc45)[nH]c3c2)CCNCC1 |
| InChI | InChI=1S/C18H17FN4S/c19-18(4-6-20-7-5-18)12-2-1-11-9-15(21-14(11)10-12)16-17-13(22-23-16)3-8-24-17/h1-3,8-10,20-21H,4-7H2,(H,22,23) |
| InChIKey | XQRGMPBDXZACPU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |