C27H30N2O9 — CID 135547531
N-[(2S,3R,4R,5S,6S)-5-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-hydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]acetamide (PubChem CID 135547531) has the molecular formula C27H30N2O9 and a molecular weight of 526.54 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6S)-5-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-hydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6S)-5-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-hydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 135547531 |
| Molecular Formula | C27H30N2O9 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | N-[(2S,3R,4R,5S,6S)-5-[(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-hydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]acetamide |
| SMILES | CCOc1cc(/C=N/[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@H](Oc3ccc4c(C)cc(=O)oc4c3)O[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C27H30N2O9/c1-4-35-21-10-16(5-8-19(21)32)12-28-24-22(13-30)38-27(25(26(24)34)29-15(3)31)36-17-6-7-18-14(2)9-23(33)37-20(18)11-17/h5-12,22,24-27,30,32,34H,4,13H2,1-3H3,(H,29,31)/b28-12+/t22-,24-,25-,26+,27-/m1/s1 |
| InChIKey | QIQLLNDJPHEBIY-KHHXRZPJSA-N |
| XLogP | 1.66 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|