C29H31N2O6S6+ — CID 135548052
3-[(2E)-2-[(2E)-2-[[1-(3-sulfopropyl)-5a,8a-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[3,2-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid (PubChem CID 135548052) has the molecular formula C29H31N2O6S6+ and a molecular weight of 695.98 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E)-2-[[1-(3-sulfopropyl)-5a,8a-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[3,2-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(2E)-2-[[1-(3-sulfopropyl)-5a,8a-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[3,2-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 135548052 |
| Molecular Formula | C29H31N2O6S6+ |
| Molecular Weight | 695.98 g/mol |
| Exact Mass | 695.05 |
| IUPAC Name | 3-[(2E)-2-[(2E)-2-[[1-(3-sulfopropyl)-5a,8a-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[3,2-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(=C\c1sc2c([n+]1CCCS(=O)(=O)O)C1C=CSC1C=C2)/C=C1/Sc2ccc3sccc3c2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C29H30N2O6S6/c1-2-19(17-26-30(11-3-15-42(32,33)34)28-20-9-13-38-22(20)5-7-24(28)40-26)18-27-31(12-4-16-43(35,36)37)29-21-10-14-39-23(21)6-8-25(29)41-27/h5-10,13-14,17-18,20,22H,2-4,11-12,15-16H2,1H3,(H-,32,33,34,35,36,37)/p+1 |
| InChIKey | WDCUPXJWXDDVDN-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.98 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|