C14H15N5O4 — CID 135548606
N-[(E)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]pyridine-4-carboxamide (PubChem CID 135548606) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[(E)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135548606 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(E)-1-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)ethylideneamino]pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H15N5O4/c1-8(16-17-11(20)9-4-6-15-7-5-9)10-12(21)18(2)14(23)19(3)13(10)22/h4-7,21H,1-3H3,(H,17,20)/b16-8+ |
| InChIKey | QPUVUFHFBJHANC-LZYBPNLTSA-N |
| XLogP | -0.66 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|