C14H17ClN2 — CID 135550564
N-benzyl-7-chloro-5-methyl-2-azabicyclo[4.1.0]heptan-3-imine (PubChem CID 135550564) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is N-benzyl-7-chloro-5-methyl-2-azabicyclo[4.1.0]heptan-3-imine.
| Compound Name | N-benzyl-7-chloro-5-methyl-2-azabicyclo[4.1.0]heptan-3-imine |
|---|---|
| PubChem CID | 135550564 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-benzyl-7-chloro-5-methyl-2-azabicyclo[4.1.0]heptan-3-imine |
| SMILES | CC1C/C(=N\Cc2ccccc2)NC2C(Cl)C12 |
| InChI | InChI=1S/C14H17ClN2/c1-9-7-11(17-14-12(9)13(14)15)16-8-10-5-3-2-4-6-10/h2-6,9,12-14H,7-8H2,1H3,(H,16,17) |
| InChIKey | FJJNRKQVADRTQP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|