C22H20N6O2 — CID 135553368
4-[(1-hydroxy-3-pyridin-3-ylpropan-2-yl)amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one (PubChem CID 135553368) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[(1-hydroxy-3-pyridin-3-ylpropan-2-yl)amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one.
| Compound Name | 4-[(1-hydroxy-3-pyridin-3-ylpropan-2-yl)amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135553368 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[(1-hydroxy-3-pyridin-3-ylpropan-2-yl)amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1cc(C)c2nc(-c3c(NC(CO)Cc4cccnc4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C22H20N6O2/c1-13-8-15(23-2)10-18-20(13)28-21(27-18)19-17(5-7-25-22(19)30)26-16(12-29)9-14-4-3-6-24-11-14/h3-8,10-11,16,29H,9,12H2,1H3,(H,27,28)(H2,25,26,30) |
| InChIKey | MOQRERASRHSHTN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|