C23H20BrN5O2 — CID 135553400
4-[[2-(3-bromo-4-methylphenyl)-2-hydroxyethyl]amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one (PubChem CID 135553400) has the molecular formula C23H20BrN5O2 and a molecular weight of 478.35 g/mol. Its IUPAC name is 4-[[2-(3-bromo-4-methylphenyl)-2-hydroxyethyl]amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one.
| Compound Name | 4-[[2-(3-bromo-4-methylphenyl)-2-hydroxyethyl]amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135553400 |
| Molecular Formula | C23H20BrN5O2 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 4-[[2-(3-bromo-4-methylphenyl)-2-hydroxyethyl]amino]-3-(6-isocyano-4-methyl-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1cc(C)c2nc(-c3c(NCC(O)c4ccc(C)c(Br)c4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C23H20BrN5O2/c1-12-4-5-14(9-16(12)24)19(30)11-27-17-6-7-26-23(31)20(17)22-28-18-10-15(25-3)8-13(2)21(18)29-22/h4-10,19,30H,11H2,1-2H3,(H,28,29)(H2,26,27,31) |
| InChIKey | VZPDFTLCTZCVEB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|