C23H23BrN6O2 — CID 142923527
3-[6-amino-4-methyl-5-(methyliminomethyl)-1H-benzimidazol-2-yl]-4-[[(2R)-2-(3-bromophenyl)-2-hydroxyethyl]amino]-1H-pyridin-2-one (PubChem CID 142923527) has the molecular formula C23H23BrN6O2 and a molecular weight of 495.38 g/mol. Its IUPAC name is 3-[6-amino-4-methyl-5-(methyliminomethyl)-1H-benzimidazol-2-yl]-4-[[(2R)-2-(3-bromophenyl)-2-hydroxyethyl]amino]-1H-pyridin-2-one.
| Compound Name | 3-[6-amino-4-methyl-5-(methyliminomethyl)-1H-benzimidazol-2-yl]-4-[[(2R)-2-(3-bromophenyl)-2-hydroxyethyl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142923527 |
| Molecular Formula | C23H23BrN6O2 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 3-[6-amino-4-methyl-5-(methyliminomethyl)-1H-benzimidazol-2-yl]-4-[[(2R)-2-(3-bromophenyl)-2-hydroxyethyl]amino]-1H-pyridin-2-one |
| SMILES | C/N=C/c1c(N)cc2[nH]c(-c3c(NC[C@H](O)c4cccc(Br)c4)cc[nH]c3=O)nc2c1C |
| InChI | InChI=1S/C23H23BrN6O2/c1-12-15(10-26-2)16(25)9-18-21(12)30-22(29-18)20-17(6-7-27-23(20)32)28-11-19(31)13-4-3-5-14(24)8-13/h3-10,19,31H,11,25H2,1-2H3,(H,29,30)(H2,27,28,32)/b26-10+/t19-/m0/s1 |
| InChIKey | YTDOUDCNMJSJQB-CZLKLAILSA-N |
| XLogP | 3.77 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|