C22H17BrClN5O3 — CID 135553385
4-[[2-(3-bromo-4-methoxyphenyl)-2-hydroxyethyl]amino]-3-(4-chloro-6-isocyano-1H-benzimidazol-2-yl)-1H-pyridin-2-one (PubChem CID 135553385) has the molecular formula C22H17BrClN5O3 and a molecular weight of 514.77 g/mol. Its IUPAC name is 4-[[2-(3-bromo-4-methoxyphenyl)-2-hydroxyethyl]amino]-3-(4-chloro-6-isocyano-1H-benzimidazol-2-yl)-1H-pyridin-2-one.
| Compound Name | 4-[[2-(3-bromo-4-methoxyphenyl)-2-hydroxyethyl]amino]-3-(4-chloro-6-isocyano-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135553385 |
| Molecular Formula | C22H17BrClN5O3 |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 4-[[2-(3-bromo-4-methoxyphenyl)-2-hydroxyethyl]amino]-3-(4-chloro-6-isocyano-1H-benzimidazol-2-yl)-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1cc(Cl)c2nc(-c3c(NCC(O)c4ccc(OC)c(Br)c4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C22H17BrClN5O3/c1-25-12-8-14(24)20-16(9-12)28-21(29-20)19-15(5-6-26-22(19)31)27-10-17(30)11-3-4-18(32-2)13(23)7-11/h3-9,17,30H,10H2,2H3,(H,28,29)(H2,26,27,31) |
| InChIKey | JGVYGKYJBYDTCP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|