C13H10N4O2S — CID 135554089
N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3H-quinazoline-2-carbothioamide (PubChem CID 135554089) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3H-quinazoline-2-carbothioamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3H-quinazoline-2-carbothioamide |
|---|---|
| PubChem CID | 135554089 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3H-quinazoline-2-carbothioamide |
| SMILES | Cc1cc(NC(=S)c2nc3ccccc3c(=O)[nH]2)no1 |
| InChI | InChI=1S/C13H10N4O2S/c1-7-6-10(17-19-7)15-13(20)11-14-9-5-3-2-4-8(9)12(18)16-11/h2-6H,1H3,(H,14,16,18)(H,15,17,20) |
| InChIKey | HEIHWKBXVPLJFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|