C12H8N4OS2 — CID 135745816
4-oxo-N-(1,3-thiazol-2-yl)-3H-quinazoline-2-carbothioamide (PubChem CID 135745816) has the molecular formula C12H8N4OS2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 4-oxo-N-(1,3-thiazol-2-yl)-3H-quinazoline-2-carbothioamide.
| Compound Name | 4-oxo-N-(1,3-thiazol-2-yl)-3H-quinazoline-2-carbothioamide |
|---|---|
| PubChem CID | 135745816 |
| Molecular Formula | C12H8N4OS2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 4-oxo-N-(1,3-thiazol-2-yl)-3H-quinazoline-2-carbothioamide |
| SMILES | O=c1[nH]c(C(=S)Nc2nccs2)nc2ccccc12 |
| InChI | InChI=1S/C12H8N4OS2/c17-10-7-3-1-2-4-8(7)14-9(15-10)11(18)16-12-13-5-6-19-12/h1-6H,(H,13,16,18)(H,14,15,17) |
| InChIKey | WZPOAGYXVAUIIV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|