C16H13N5O4S2 — CID 135748626
ethyl 2-hydroxyimino-2-[2-[(4-oxo-3H-quinazoline-2-carbothioyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 135748626) has the molecular formula C16H13N5O4S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is ethyl 2-hydroxyimino-2-[2-[(4-oxo-3H-quinazoline-2-carbothioyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-hydroxyimino-2-[2-[(4-oxo-3H-quinazoline-2-carbothioyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 135748626 |
| Molecular Formula | C16H13N5O4S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | ethyl 2-hydroxyimino-2-[2-[(4-oxo-3H-quinazoline-2-carbothioyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)C(=NO)c1csc(NC(=S)c2nc3ccccc3c(=O)[nH]2)n1 |
| InChI | InChI=1S/C16H13N5O4S2/c1-2-25-15(23)11(21-24)10-7-27-16(18-10)20-14(26)12-17-9-6-4-3-5-8(9)13(22)19-12/h3-7,24H,2H2,1H3,(H,17,19,22)(H,18,20,26) |
| InChIKey | OBMCOZOENRDDFM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|