C17H11N5OS2 — CID 135824906
4-oxo-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-3H-quinazoline-2-carbothioamide (PubChem CID 135824906) has the molecular formula C17H11N5OS2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-oxo-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-3H-quinazoline-2-carbothioamide.
| Compound Name | 4-oxo-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-3H-quinazoline-2-carbothioamide |
|---|---|
| PubChem CID | 135824906 |
| Molecular Formula | C17H11N5OS2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-oxo-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-3H-quinazoline-2-carbothioamide |
| SMILES | O=c1[nH]c(C(=S)Nc2nc(-c3ccccc3)ns2)nc2ccccc12 |
| InChI | InChI=1S/C17H11N5OS2/c23-15-11-8-4-5-9-12(11)18-14(19-15)16(24)21-17-20-13(22-25-17)10-6-2-1-3-7-10/h1-9H,(H,18,19,23)(H,20,21,22,24) |
| InChIKey | ULCZGWFPYOBFRL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|