C13H15N3O4S — CID 135722019
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-oxo-3H-quinazoline-2-carbothioamide (PubChem CID 135722019) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-oxo-3H-quinazoline-2-carbothioamide.
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-oxo-3H-quinazoline-2-carbothioamide |
|---|---|
| PubChem CID | 135722019 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-oxo-3H-quinazoline-2-carbothioamide |
| SMILES | O=c1[nH]c(C(=S)NC(CO)(CO)CO)nc2ccccc12 |
| InChI | InChI=1S/C13H15N3O4S/c17-5-13(6-18,7-19)16-12(21)10-14-9-4-2-1-3-8(9)11(20)15-10/h1-4,17-19H,5-7H2,(H,16,21)(H,14,15,20) |
| InChIKey | VGVIFTGCRUPADN-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|