C15H17N3O6S — CID 135765746
4-oxo-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]-3H-quinazoline-2-carbothioamide (PubChem CID 135765746) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-oxo-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]-3H-quinazoline-2-carbothioamide.
| Compound Name | 4-oxo-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]-3H-quinazoline-2-carbothioamide |
|---|---|
| PubChem CID | 135765746 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-oxo-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]-3H-quinazoline-2-carbothioamide |
| SMILES | O=c1[nH]c(C(=S)NC2C(O)OC(CO)C(O)C2O)nc2ccccc12 |
| InChI | InChI=1S/C15H17N3O6S/c19-5-8-10(20)11(21)9(15(23)24-8)17-14(25)12-16-7-4-2-1-3-6(7)13(22)18-12/h1-4,8-11,15,19-21,23H,5H2,(H,17,25)(H,16,18,22) |
| InChIKey | MRJRJWCWZFAWKZ-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 147.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|