C15H16FN3OS — CID 135554552
2-[(2-ethyl-7-fluoro-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-ylidene)amino]ethanol (PubChem CID 135554552) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[(2-ethyl-7-fluoro-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-ylidene)amino]ethanol.
| Compound Name | 2-[(2-ethyl-7-fluoro-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-ylidene)amino]ethanol |
|---|---|
| PubChem CID | 135554552 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[(2-ethyl-7-fluoro-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-ylidene)amino]ethanol |
| SMILES | CCc1cc2c(s1)Nc1ccc(F)cc1N/C2=N\CCO |
| InChI | InChI=1S/C15H16FN3OS/c1-2-10-8-11-14(17-5-6-20)18-13-7-9(16)3-4-12(13)19-15(11)21-10/h3-4,7-8,19-20H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | NNJVJKASGSCSSZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|