C22H16ClN3O2 — CID 135559242
4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-methylphenyl)benzamide (PubChem CID 135559242) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is 4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-methylphenyl)benzamide.
| Compound Name | 4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 135559242 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(/N=C3\C(=O)Nc4ccc(Cl)cc43)cc2)cc1 |
| InChI | InChI=1S/C22H16ClN3O2/c1-13-2-7-17(8-3-13)25-21(27)14-4-9-16(10-5-14)24-20-18-12-15(23)6-11-19(18)26-22(20)28/h2-12H,1H3,(H,25,27)(H,24,26,28) |
| InChIKey | FBOCBFKRPOYNMX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|