C22H18N4O4S — CID 137226402
4-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 137226402) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 137226402 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | Cc1ccc2c(c1)/C(=N/c1ccc(C(=O)Nc3ccc(S(N)(=O)=O)cc3)cc1)C(=O)N2 |
| InChI | InChI=1S/C22H18N4O4S/c1-13-2-11-19-18(12-13)20(22(28)26-19)24-15-5-3-14(4-6-15)21(27)25-16-7-9-17(10-8-16)31(23,29)30/h2-12H,1H3,(H,25,27)(H2,23,29,30)(H,24,26,28) |
| InChIKey | AETBZXKNLNTEJY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|